4-PA
1-(4-Propoxyphenyl)propan-2-amine
 6326 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-3-8-14-12-6-4-11(5-7-12)9-10(2)13/h4-7,10H,3,8-9,13H2,1-2H3
 NVNUOGJMXPVHLF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCOc1ccc(cc1)CC(N)C