4-EtO-α-EtPEA
1-(4-Ethoxyphenyl)butan-2-amine
 6324 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-3-11(13)9-10-5-7-12(8-6-10)14-4-2/h5-8,11H,3-4,9,13H2,1-2H3
 ZUNPLRQCUQCXBS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccc(cc1)CC(CC)N