4-EPEA
2-(4-Ethoxyphenyl)ethan-1-amine
 6319 C10H15NO 165.232
 InChI=1S/C10H15NO/c1-2-12-10-5-3-9(4-6-10)7-8-11/h3-6H,2,7-8,11H2,1H3
 OQIMYLCOTAZDEZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1)OCC