1,2-Dimethyl-3-phenylaziridine
 6316 C10H13N 147.217
 InChI=1S/C10H13N/c1-8-10(11(8)2)9-6-4-3-5-7-9/h3-8,10H,1-2H3
 MKCZABZZOZOQTK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN1C(C1C)c1ccccc1