β-Me-PMMA
3-(4-Methoxyphenyl)-N-methylbutan-2-amine
 6309 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-9(10(2)13-3)11-5-7-12(14-4)8-6-11/h5-10,13H,1-4H3
 QJNIKEVKIPDGSH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(c1ccc(cc1)OC)C)C