β,4-DMPEA
2-Methoxy-2-(4-methoxyphenyl)ethan-1-amine
 6303 C10H15NO2 181.232
 InChI=1S/C10H15NO2/c1-12-9-5-3-8(4-6-9)10(7-11)13-2/h3-6,10H,7,11H2,1-2H3
 VQMILJNGYNHZHB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1)C(CN)OC