β-Me-N-Et-4-MPEA
N-Ethyl-2-(4-methoxyphenyl)propan-1-amine
 6302 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-4-13-9-10(2)11-5-7-12(14-3)8-6-11/h5-8,10,13H,4,9H2,1-3H3
 DUFJJJBGSZSQPQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNCC(c1ccc(cc1)OC)C