β,N,N-Me-4-MPEA
2-(4-Methoxyphenyl)-N,N-dimethylpropan-1-amine
 6301 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-10(9-13(2)3)11-5-7-12(14-4)8-6-11/h5-8,10H,9H2,1-4H3
 XIBVWCVANOGMLT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1)C(CN(C)C)C