β-Me-4-MPEA
2-(4-Methoxyphenyl)propan-1-amine
 6286 C10H15NO 165.232
 InChI=1S/C10H15NO/c1-8(7-11)9-3-5-10(12-2)6-4-9/h3-6,8H,7,11H2,1-2H3
 LUOOSDUSUYCCFY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1ccc(cc1)OC)C