N-Me-4-MPEA
2-(4-Methoxyphenyl)-N-methylethan-1-amine
 6283 C10H15NO 165.232
 InChI=1S/C10H15NO/c1-11-8-7-9-3-5-10(12-2)6-4-9/h3-6,11H,7-8H2,1-2H3
 JCMWSVNNSPUNER-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1ccc(cc1)OC