AcO-MePEA
4-[2-(Methylamino)ethyl]phenyl acetate
 6280 C11H15NO2 193.242
 InChI=1S/C11H15NO2/c1-9(13)14-11-5-3-10(4-6-11)7-8-12-2/h3-6,12H,7-8H2,1-2H3
 DECDGWUADYCTRV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1ccc(cc1)OC(=O)C