β-MeO-HMePEA
4-[1-Methoxy-2-(methylamino)ethyl]phenol
 6271 C10H15NO2 181.232
 InChI=1S/C10H15NO2/c1-11-7-10(13-2)8-3-5-9(12)6-4-8/h3-6,10-12H,7H2,1-2H3
 LVZUJPSBCGHXGZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCC(c1ccc(cc1)O)OC