β-Me-HPEA
4-(1-Aminopropan-2-yl)phenol
 6267 C9H13NO 151.206
 InChI=1S/C9H13NO/c1-7(6-10)8-2-4-9(11)5-3-8/h2-5,7,11H,6,10H2,1H3
 ZGYDQXZKRDEGFR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1ccc(cc1)O)C