4-BuPEA
2-(4-Butylphenyl)ethan-1-amine
 6260 C12H19N 177.286
 InChI=1S/C12H19N/c1-2-3-4-11-5-7-12(8-6-11)9-10-13/h5-8H,2-4,9-10,13H2,1H3
 ZWVAEXGUCYEOBM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCc1ccc(cc1)CCN