4-PrA
1-(4-Propylphenyl)propan-2-amine
 6257 C12H19N 177.286
 InChI=1S/C12H19N/c1-3-4-11-5-7-12(8-6-11)9-10(2)13/h5-8,10H,3-4,9,13H2,1-2H3
 MRPZLQUGNPYVGK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCc1ccc(cc1)CC(N)C