N-Acetal-MDA
N-[1-(2H-1,3-Benzodioxol-5-yl)propan-2-yl]acetamide
 6244 C12H15NO3 221.252
 InChI=1S/C12H15NO3/c1-8(13-9(2)14)5-10-3-4-11-12(6-10)16-7-15-11/h3-4,6,8H,5,7H2,1-2H3,(H,13,14)
 RSXXYTIHSOOFBG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc2c(c1)OCO2)NC(=O)C