homo-TMA-3
4-(2,3,4-Trimethoxyphenyl)butan-2-amine
 622 C13H21NO3 239.311
 InChI=1S/C13H21NO3/c1-9(14)5-6-10-7-8-11(15-2)13(17-4)12(10)16-3/h7-9H,5-6,14H2,1-4H3
 JZNQOQZDPWRYGP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(CCC(N)C)ccc(c1OC)OC