nPr-NKE-Pr
Propyl 4-{[1-(2-chlorophenyl)-2-oxocyclohexyl]amino}butanoate
 6211 C19H26ClNO3 351.868
 Arylcycloalkylamine
 InChI=1S/C19H26ClNO3/c1-2-14-24-18(23)11-7-13-21-19(12-6-5-10-17(19)22)15-8-3-4-9-16(15)20/h3-4,8-9,21H,2,5-7,10-14H2,1H3
 VBIALSIHBKQBCK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCOC(=O)CCCNC1(CCCCC1=O)c1ccccc1Cl