homo-DOM
4-(2,5-Dimethoxy-4-methylphenyl)butan-2-amine
 621 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-9-7-13(16-4)11(6-5-10(2)14)8-12(9)15-3/h7-8,10H,5-6,14H2,1-4H3
 KPNGIGQMSMWOKZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C)c(cc1CCC(N)C)OC