BO3EE
2-Ethoxy-2-(3-ethoxyphenyl)ethan-1-amine
 6202 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-3-14-11-7-5-6-10(8-11)12(9-13)15-4-2/h5-8,12H,3-4,9,13H2,1-2H3
 SIXDGIDZTMJMHW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cccc(c1)C(OCC)CN