m-Fluoro-acetylfentanyl
N-(3-Fluorophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]acetamide
 6190 C21H25FN2O 340.434
 Fentanyl
 InChI=1S/C21H25FN2O/c1-17(25)24(21-9-5-8-19(22)16-21)20-11-14-23(15-12-20)13-10-18-6-3-2-4-7-18/h2-9,16,20H,10-15H2,1H3
 ALHJAWKAFTYWPM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Fc1cccc(c1)N(C1CCN(CC1)CCc1ccccc1)C(=O)C