β-Methyl-acetylfentanyl
N-Phenyl-N-[1-(2-phenylpropyl)piperidin-4-yl]acetamide
 6189 C22H28N2O 336.471
 Fentanyl
 InChI=1S/C22H28N2O/c1-18(20-9-5-3-6-10-20)17-23-15-13-22(14-16-23)24(19(2)25)21-11-7-4-8-12-21/h3-12,18,22H,13-17H2,1-2H3
 MDRBZPCJVBUXSG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(c1ccccc1)CN1CCC(CC1)N(c1ccccc1)C(=O)C