4C-3-MPEA
1-(3-Methoxyphenyl)butan-2-amine
 6184 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-3-10(12)7-9-5-4-6-11(8-9)13-2/h4-6,8,10H,3,7,12H2,1-2H3
 AMYLOVNRTOBLMY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(Cc1cccc(c1)OC)N