N-Bu-3-MA
N-[1-(3-Methoxyphenyl)propan-2-yl]butan-1-amine
 6183 C14H23NO 221.339
 InChI=1S/C14H23NO/c1-4-5-9-15-12(2)10-13-7-6-8-14(11-13)16-3/h6-8,11-12,15H,4-5,9-10H2,1-3H3
 YPJOYGZWGYBIJC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCNC(Cc1cccc(c1)OC)C