N,N-Et-3-MA
N,N-Diethyl-1-(3-methoxyphenyl)propan-2-amine
 6182 C14H23NO 221.339
 InChI=1S/C14H23NO/c1-5-15(6-2)12(3)10-13-8-7-9-14(11-13)16-4/h7-9,11-12H,5-6,10H2,1-4H3
 PBVMTNWRWRQDNH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(C(Cc1cccc(c1)OC)C)CC