homo-N,N-Me-2,5-DMPEA
3-(2,5-Dimethoxyphenyl)-N,N-dimethylpropan-1-amine
 618 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-14(2)9-5-6-11-10-12(15-3)7-8-13(11)16-4/h7-8,10H,5-6,9H2,1-4H3
 QFTGOESDVVPZHW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1CCCN(C)C)OC