β-Me-3-MMA
3-(3-Methoxyphenyl)-N-methylbutan-2-amine
 6178 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-9(10(2)13-3)11-6-5-7-12(8-11)14-4/h5-10,13H,1-4H3
 GCUNRPUROUKNBS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(c1cccc(c1)OC)C)C