3″-Methylfentanyl
N-{1-[2-(3-Methylphenyl)ethyl]piperidin-4-yl}-N-phenylpropanamide
 6177 C23H30N2O 350.497
 Fentanyl
 InChI=1S/C23H30N2O/c1-3-23(26)25(21-10-5-4-6-11-21)22-13-16-24(17-14-22)15-12-20-9-7-8-19(2)18-20/h4-11,18,22H,3,12-17H2,1-2H3
 RBPHYEMEGYTXGK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(=O)N(c1ccccc1)C1CCN(CC1)CCc1cccc(c1)C