MO3MB
N-[2-Methoxy-2-(3-methoxyphenyl)ethyl]butan-1-amine
 6173 C14H23NO2 237.338
 InChI=1S/C14H23NO2/c1-4-5-9-15-11-14(17-3)12-7-6-8-13(10-12)16-2/h6-8,10,14-15H,4-5,9,11H2,1-3H3
 UMVWIQKAAQZETE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCNCC(c1cccc(c1)OC)OC