BO3MIP
N-[2-Methoxy-2-(3-methoxyphenyl)ethyl]propan-2-amine
 6172 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-10(2)14-9-13(16-4)11-6-5-7-12(8-11)15-3/h5-8,10,13-14H,9H2,1-4H3
 KSVUKXYFGWLQNF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COC(c1cccc(c1)OC)CNC(C)C