BO3MM
2-Methoxy-2-(3-methoxyphenyl)-N-methylethan-1-amine
 6169 C11H17NO2 195.258
 InChI=1S/C11H17NO2/c1-12-8-11(14-3)9-5-4-6-10(7-9)13-2/h4-7,11-12H,8H2,1-3H3
 OYKAQMUUZGTZBP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCC(c1cccc(c1)OC)OC