N,N-Et-3-MPEA
N,N-Diethyl-2-(3-methoxyphenyl)ethan-1-amine
 6165 C13H21NO 207.312
 InChI=1S/C13H21NO/c1-4-14(5-2)10-9-12-7-6-8-13(11-12)15-3/h6-8,11H,4-5,9-10H2,1-3H3
 WSPVURPVOWOYQC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(CCc1cccc(c1)OC)CC