N-Et-3-MPEA
N-Ethyl-2-(3-methoxyphenyl)ethan-1-amine
 6164 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-3-12-8-7-10-5-4-6-11(9-10)13-2/h4-6,9,12H,3,7-8H2,1-2H3
 QVAZAZYBVWHEHA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNCCc1cccc(c1)OC