N,N-Me-3-MPEA
2-(3-Methoxyphenyl)-N,N-dimethylethan-1-amine
 6163 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-12(2)8-7-10-5-4-6-11(9-10)13-3/h4-6,9H,7-8H2,1-3H3
 MDJHIMAJKNGSEZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cccc(c1)CCN(C)C