N-Me-3-MPEA
2-(3-Methoxyphenyl)-N-methylethan-1-amine
 6162 C10H15NO 165.232
 InChI=1S/C10H15NO/c1-11-7-6-9-4-3-5-10(8-9)12-2/h3-5,8,11H,6-7H2,1-2H3
 MCGDBHZRFQKLBT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1cccc(c1)OC