N-Et-3-HA
3-[2-(Ethylamino)propyl]phenol
 6159 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-3-12-9(2)7-10-5-4-6-11(13)8-10/h4-6,8-9,12-13H,3,7H2,1-2H3
 ATGJQGPNRFTOAL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(Cc1cccc(c1)O)C