N,N-Me-3-HPEA
3-[2-(Dimethylamino)ethyl]phenol
 6154 C10H15NO 165.232
 InChI=1S/C10H15NO/c1-11(2)7-6-9-4-3-5-10(12)8-9/h3-5,8,12H,6-7H2,1-2H3
 DZZZXJVECUJDRB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1cccc(c1)O)C