3-HMPEA
3-[2-(Methylamino)ethyl]phenol
 6153 C9H13NO 151.206
 InChI=1S/C9H13NO/c1-10-6-5-8-3-2-4-9(11)7-8/h2-4,7,10-11H,5-6H2,1H3
 ZEWFJYYLEOBCNY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1cccc(c1)O