m-Methyl-acetylfentanyl
N-(3-Methylphenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]acetamide
 6149 C22H28N2O 336.471
 Fentanyl
 InChI=1S/C22H28N2O/c1-18-7-6-10-22(17-18)24(19(2)25)21-12-15-23(16-13-21)14-11-20-8-4-3-5-9-20/h3-10,17,21H,11-16H2,1-2H3
 SZZZZTBKJBQTDR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Cc1cccc(c1)N(C1CCN(CC1)CCc1ccccc1)C(=O)C