Phenylpropyl-acetyl-norfentanyl
N-Phenyl-N-[1-(3-phenylpropyl)piperidin-4-yl]acetamide
 6148 C22H28N2O 336.471
 Fentanyl
 InChI=1S/C22H28N2O/c1-19(25)24(21-12-6-3-7-13-21)22-14-17-23(18-15-22)16-8-11-20-9-4-2-5-10-20/h2-7,9-10,12-13,22H,8,11,14-18H2,1H3
 QZTILTHMQXTRFP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(=O)N(c1ccccc1)C1CCN(CC1)CCCc1ccccc1