N-Et-3-NO2A
N-Ethyl-1-(3-nitrophenyl)propan-2-amine
 6130  C11H16N2O2  208.257
 InChI=1S/C11H16N2O2/c1-3-12-9(2)7-10-5-4-6-11(8-10)13(14)15/h4-6,8-9,12H,3,7H2,1-2H3
 KKDJOGFRUVZXFJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(Cc1cccc(c1)N(=O)=O)C