N-Et-3-IA
N-Ethyl-1-(3-iodophenyl)propan-2-amine
 6129  C11H16IN  289.156
 InChI=1S/C11H16IN/c1-3-13-9(2)7-10-5-4-6-11(12)8-10/h4-6,8-9,13H,3,7H2,1-2H3
 FJAHIELKCIWMNX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(Cc1cccc(c1)I)C