N-Et-3-BA
1-(3-Bromophenyl)-N-ethylpropan-2-amine
 6127  C11H16BrN  242.155
 InChI=1S/C11H16BrN/c1-3-13-9(2)7-10-5-4-6-11(12)8-10/h4-6,8-9,13H,3,7H2,1-2H3
 AAVUCOBJHRAQLW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(Cc1cccc(c1)Br)C