N-Et-3-CA
1-(3-Chlorophenyl)-N-ethylpropan-2-amine
 6125  C11H16ClN  197.704
 InChI=1S/C11H16ClN/c1-3-13-9(2)7-10-5-4-6-11(12)8-10/h4-6,8-9,13H,3,7H2,1-2H3
 RFNFLLWJLUDKJZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(Cc1cccc(c1)Cl)C