3-Cl-PEA
2-(3-Chlorophenyl)ethan-1-amine
 6123  C8H10ClN  155.625
 InChI=1S/C8H10ClN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4-5,10H2
 NRHVNPYOTNGECT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cccc(c1)Cl