N-pip-2-MA
1-[1-(2-Methoxyphenyl)propan-2-yl]piperidine
 6114 C15H23NO 233.349
 InChI=1S/C15H23NO/c1-13(16-10-6-3-7-11-16)12-14-8-4-5-9-15(14)17-2/h4-5,8-9,13H,3,6-7,10-12H2,1-2H3
 URCPTLOZDHGEKH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccccc1CC(N1CCCCC1)C