β-Me-2-MMA
3-(2-Methoxyphenyl)-N-methylbutan-2-amine
 6102 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-9(10(2)13-3)11-7-5-6-8-12(11)14-4/h5-10,13H,1-4H3
 GNDRALUYSQLXHW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(c1ccccc1OC)C)C