homo-DMA
4-(3,4-Dimethoxyphenyl)butan-2-amine
 608 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-9(13)4-5-10-6-7-11(14-2)12(8-10)15-3/h6-9H,4-5,13H2,1-3H3
 GKVCAXLHDBMIPO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CCC(N)C)ccc1OC