N-Me-2-MPEA
2-(2-Methoxyphenyl)-N-methylethan-1-amine
 6079 C10H15NO 165.232
 InChI=1S/C10H15NO/c1-11-8-7-9-5-3-4-6-10(9)12-2/h3-6,11H,7-8H2,1-2H3
 UCAUHTUMXIYKFJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1ccccc1OC