2-HA
2-(2-Aminopropyl)phenol
 6076 C9H13NO 151.206
 InChI=1S/C9H13NO/c1-7(10)6-8-4-2-3-5-9(8)11/h2-5,7,11H,6,10H2,1H3
 BCYNCBWCTHFJIU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1O)N